C19H22O5S2 — CID 45101684
[4,4-bis(benzenesulfonyl)-2-methylcyclopentyl]methanol (PubChem CID 45101684) has the molecular formula C19H22O5S2 and a molecular weight of 394.51 g/mol. Its IUPAC name is [4,4-bis(benzenesulfonyl)-2-methylcyclopentyl]methanol.
| Compound Name | [4,4-bis(benzenesulfonyl)-2-methylcyclopentyl]methanol |
|---|---|
| PubChem CID | 45101684 |
| Molecular Formula | C19H22O5S2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | [4,4-bis(benzenesulfonyl)-2-methylcyclopentyl]methanol |
| SMILES | CC1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)CC1CO |
| InChI | InChI=1S/C19H22O5S2/c1-15-12-19(13-16(15)14-20,25(21,22)17-8-4-2-5-9-17)26(23,24)18-10-6-3-7-11-18/h2-11,15-16,20H,12-14H2,1H3 |
| InChIKey | GBXYPZVVGRISIL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |