C24H26O4S2 — CID 101471600
(3aR,7aS)-2,2-bis(benzenesulfonyl)-4-propan-2-ylidene-3,3a,5,7a-tetrahydro-1H-indene (PubChem CID 101471600) has the molecular formula C24H26O4S2 and a molecular weight of 442.60 g/mol. Its IUPAC name is (3aR,7aS)-2,2-bis(benzenesulfonyl)-4-propan-2-ylidene-3,3a,5,7a-tetrahydro-1H-indene.
| Compound Name | (3aR,7aS)-2,2-bis(benzenesulfonyl)-4-propan-2-ylidene-3,3a,5,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 101471600 |
| Molecular Formula | C24H26O4S2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (3aR,7aS)-2,2-bis(benzenesulfonyl)-4-propan-2-ylidene-3,3a,5,7a-tetrahydro-1H-indene |
| SMILES | CC(C)=C1CC=C[C@@H]2CC(S(=O)(=O)c3ccccc3)(S(=O)(=O)c3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C24H26O4S2/c1-18(2)22-15-9-10-19-16-24(17-23(19)22,29(25,26)20-11-5-3-6-12-20)30(27,28)21-13-7-4-8-14-21/h3-14,19,23H,15-17H2,1-2H3/t19-,23-/m1/s1 |
| InChIKey | XBUZMFXDOASODS-AUSIDOKSSA-N |
| XLogP | 4.95 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|