C20H20O5S2 — CID 11729158
2-[4,4-bis(benzenesulfonyl)-2-methylidenecyclopentyl]acetaldehyde (PubChem CID 11729158) has the molecular formula C20H20O5S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[4,4-bis(benzenesulfonyl)-2-methylidenecyclopentyl]acetaldehyde.
| Compound Name | 2-[4,4-bis(benzenesulfonyl)-2-methylidenecyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 11729158 |
| Molecular Formula | C20H20O5S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-[4,4-bis(benzenesulfonyl)-2-methylidenecyclopentyl]acetaldehyde |
| SMILES | C=C1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)CC1CC=O |
| InChI | InChI=1S/C20H20O5S2/c1-16-14-20(15-17(16)12-13-21,26(22,23)18-8-4-2-5-9-18)27(24,25)19-10-6-3-7-11-19/h2-11,13,17H,1,12,14-15H2 |
| InChIKey | LQFHMWZNPKLGNE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|