C24H26O4S2 — CID 102469207
(4R,5R)-2,2-bis(benzenesulfonyl)-4-ethenyl-8-methylidenespiro[4.4]nonane (PubChem CID 102469207) has the molecular formula C24H26O4S2 and a molecular weight of 442.60 g/mol. Its IUPAC name is (4R,5R)-2,2-bis(benzenesulfonyl)-4-ethenyl-8-methylidenespiro[4.4]nonane.
| Compound Name | (4R,5R)-2,2-bis(benzenesulfonyl)-4-ethenyl-8-methylidenespiro[4.4]nonane |
|---|---|
| PubChem CID | 102469207 |
| Molecular Formula | C24H26O4S2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (4R,5R)-2,2-bis(benzenesulfonyl)-4-ethenyl-8-methylidenespiro[4.4]nonane |
| SMILES | C=C[C@H]1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C[C@]12CCC(=C)C2 |
| InChI | InChI=1S/C24H26O4S2/c1-3-20-17-24(18-23(20)15-14-19(2)16-23,29(25,26)21-10-6-4-7-11-21)30(27,28)22-12-8-5-9-13-22/h3-13,20H,1-2,14-18H2/t20-,23+/m0/s1 |
| InChIKey | KEMLMHKDBSTXFU-NZQKXSOJSA-N |
| XLogP | 4.95 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|