C24H28O6S2 — CID 101488453
(2R,6R)-4,4-bis(benzenesulfonyl)-2-ethenyl-6-[(2R)-2-methyloxolan-2-yl]oxane (PubChem CID 101488453) has the molecular formula C24H28O6S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is (2R,6R)-4,4-bis(benzenesulfonyl)-2-ethenyl-6-[(2R)-2-methyloxolan-2-yl]oxane.
| Compound Name | (2R,6R)-4,4-bis(benzenesulfonyl)-2-ethenyl-6-[(2R)-2-methyloxolan-2-yl]oxane |
|---|---|
| PubChem CID | 101488453 |
| Molecular Formula | C24H28O6S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (2R,6R)-4,4-bis(benzenesulfonyl)-2-ethenyl-6-[(2R)-2-methyloxolan-2-yl]oxane |
| SMILES | C=C[C@H]1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C[C@H]([C@@]2(C)CCCO2)O1 |
| InChI | InChI=1S/C24H28O6S2/c1-3-19-17-24(31(25,26)20-11-6-4-7-12-20,32(27,28)21-13-8-5-9-14-21)18-22(30-19)23(2)15-10-16-29-23/h3-9,11-14,19,22H,1,10,15-18H2,2H3/t19-,22+,23+/m0/s1 |
| InChIKey | ORZJCPJYBWLYIA-WWPVKYPJSA-N |
| XLogP | 3.93 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|