C36H44O4 — CID 139125497
(5R,7R,9R)-7-methyl-9-phenyl-9-prop-2-enyl-1-oxaspiro[4.4]nonan-6-one (PubChem CID 139125497) has the molecular formula C36H44O4 and a molecular weight of 540.74 g/mol. Its IUPAC name is (5R,7R,9R)-7-methyl-9-phenyl-9-prop-2-enyl-1-oxaspiro[4.4]nonan-6-one.
| Compound Name | (5R,7R,9R)-7-methyl-9-phenyl-9-prop-2-enyl-1-oxaspiro[4.4]nonan-6-one |
|---|---|
| PubChem CID | 139125497 |
| Molecular Formula | C36H44O4 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | (5R,7R,9R)-7-methyl-9-phenyl-9-prop-2-enyl-1-oxaspiro[4.4]nonan-6-one |
| SMILES | C=CC[C@]1(c2ccccc2)C[C@@H](C)C(=O)[C@@]12CCCO2.C=CC[C@]1(c2ccccc2)C[C@@H](C)C(=O)[C@@]12CCCO2 |
| InChI | InChI=1S/2C18H22O2/c2*1-3-10-17(15-8-5-4-6-9-15)13-14(2)16(19)18(17)11-7-12-20-18/h2*3-6,8-9,14H,1,7,10-13H2,2H3/t2*14-,17-,18+/m11/s1 |
| InChIKey | IIXAJHBXORPUQI-AQQHVGIFSA-N |
| XLogP | 7.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|