C21H22O3 — CID 14141966
2-methoxy-5-(2-oxopropyl)-3,4-diphenylcyclopentan-1-one (PubChem CID 14141966) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-methoxy-5-(2-oxopropyl)-3,4-diphenylcyclopentan-1-one.
| Compound Name | 2-methoxy-5-(2-oxopropyl)-3,4-diphenylcyclopentan-1-one |
|---|---|
| PubChem CID | 14141966 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-methoxy-5-(2-oxopropyl)-3,4-diphenylcyclopentan-1-one |
| SMILES | COC1C(=O)C(CC(C)=O)C(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C21H22O3/c1-14(22)13-17-18(15-9-5-3-6-10-15)19(21(24-2)20(17)23)16-11-7-4-8-12-16/h3-12,17-19,21H,13H2,1-2H3 |
| InChIKey | BJSRSDHHPILODQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |