C27H34O6S2Si — CID 11071654
ethyl (2E)-2-[4,4-bis(benzenesulfonyl)-2-[(Z)-1-trimethylsilylprop-1-en-2-yl]cyclopentylidene]acetate (PubChem CID 11071654) has the molecular formula C27H34O6S2Si and a molecular weight of 546.78 g/mol. Its IUPAC name is ethyl (2E)-2-[4,4-bis(benzenesulfonyl)-2-[(Z)-1-trimethylsilylprop-1-en-2-yl]cyclopentylidene]acetate.
| Compound Name | ethyl (2E)-2-[4,4-bis(benzenesulfonyl)-2-[(Z)-1-trimethylsilylprop-1-en-2-yl]cyclopentylidene]acetate |
|---|---|
| PubChem CID | 11071654 |
| Molecular Formula | C27H34O6S2Si |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | ethyl (2E)-2-[4,4-bis(benzenesulfonyl)-2-[(Z)-1-trimethylsilylprop-1-en-2-yl]cyclopentylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)CC1/C(C)=C\[Si](C)(C)C |
| InChI | InChI=1S/C27H34O6S2Si/c1-6-33-26(28)17-22-18-27(19-25(22)21(2)20-36(3,4)5,34(29,30)23-13-9-7-10-14-23)35(31,32)24-15-11-8-12-16-24/h7-17,20,25H,6,18-19H2,1-5H3/b21-20-,22-17+ |
| InChIKey | XSRGSJUGVBNALO-DDBSYNCKSA-N |
| XLogP | 5.35 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|