C16H18O4S — CID 134872793
ethyl 1-(benzenesulfonyl)-2-[(1E)-buta-1,3-dienyl]cyclopropane-1-carboxylate (PubChem CID 134872793) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is ethyl 1-(benzenesulfonyl)-2-[(1E)-buta-1,3-dienyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-(benzenesulfonyl)-2-[(1E)-buta-1,3-dienyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134872793 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | ethyl 1-(benzenesulfonyl)-2-[(1E)-buta-1,3-dienyl]cyclopropane-1-carboxylate |
| SMILES | C=C/C=C/C1CC1(C(=O)OCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18O4S/c1-3-5-9-13-12-16(13,15(17)20-4-2)21(18,19)14-10-7-6-8-11-14/h3,5-11,13H,1,4,12H2,2H3/b9-5+ |
| InChIKey | LKALHAGVVCHPCA-WEVVVXLNSA-N |
| XLogP | 2.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|