C22H26O5S2 — CID 11384998
[1-(benzenesulfonyl)-3-(2-methoxypropan-2-yl)-4-methylidenecyclopentyl]sulfonylbenzene (PubChem CID 11384998) has the molecular formula C22H26O5S2 and a molecular weight of 434.58 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-3-(2-methoxypropan-2-yl)-4-methylidenecyclopentyl]sulfonylbenzene.
| Compound Name | [1-(benzenesulfonyl)-3-(2-methoxypropan-2-yl)-4-methylidenecyclopentyl]sulfonylbenzene |
|---|---|
| PubChem CID | 11384998 |
| Molecular Formula | C22H26O5S2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | [1-(benzenesulfonyl)-3-(2-methoxypropan-2-yl)-4-methylidenecyclopentyl]sulfonylbenzene |
| SMILES | C=C1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)CC1C(C)(C)OC |
| InChI | InChI=1S/C22H26O5S2/c1-17-15-22(16-20(17)21(2,3)27-4,28(23,24)18-11-7-5-8-12-18)29(25,26)19-13-9-6-10-14-19/h5-14,20H,1,15-16H2,2-4H3 |
| InChIKey | CMOOABBWELSJMA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|