C24H28O5S2 — CID 134866858
[1-(benzenesulfonyl)-3-methylidene-4-(2-prop-2-enoxypropan-2-yl)cyclopentyl]sulfonylbenzene (PubChem CID 134866858) has the molecular formula C24H28O5S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-3-methylidene-4-(2-prop-2-enoxypropan-2-yl)cyclopentyl]sulfonylbenzene.
| Compound Name | [1-(benzenesulfonyl)-3-methylidene-4-(2-prop-2-enoxypropan-2-yl)cyclopentyl]sulfonylbenzene |
|---|---|
| PubChem CID | 134866858 |
| Molecular Formula | C24H28O5S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | [1-(benzenesulfonyl)-3-methylidene-4-(2-prop-2-enoxypropan-2-yl)cyclopentyl]sulfonylbenzene |
| SMILES | C=CCOC(C)(C)C1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)CC1=C |
| InChI | InChI=1S/C24H28O5S2/c1-5-16-29-23(3,4)22-18-24(17-19(22)2,30(25,26)20-12-8-6-9-13-20)31(27,28)21-14-10-7-11-15-21/h5-15,22H,1-2,16-18H2,3-4H3 |
| InChIKey | QDVWYBZTIPFBDI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|