C23H24O3S — CID 135061977
(1R,4S)-4-(benzenesulfonyl)-3,3-dimethyl-1-[(E)-2-phenylethenyl]-1,3a,4,6a-tetrahydrocyclopenta[c]furan (PubChem CID 135061977) has the molecular formula C23H24O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is (1R,4S)-4-(benzenesulfonyl)-3,3-dimethyl-1-[(E)-2-phenylethenyl]-1,3a,4,6a-tetrahydrocyclopenta[c]furan.
| Compound Name | (1R,4S)-4-(benzenesulfonyl)-3,3-dimethyl-1-[(E)-2-phenylethenyl]-1,3a,4,6a-tetrahydrocyclopenta[c]furan |
|---|---|
| PubChem CID | 135061977 |
| Molecular Formula | C23H24O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (1R,4S)-4-(benzenesulfonyl)-3,3-dimethyl-1-[(E)-2-phenylethenyl]-1,3a,4,6a-tetrahydrocyclopenta[c]furan |
| SMILES | CC1(C)O[C@H](/C=C/c2ccccc2)C2C=C[C@H](S(=O)(=O)c3ccccc3)C21 |
| InChI | InChI=1S/C23H24O3S/c1-23(2)22-19(20(26-23)15-13-17-9-5-3-6-10-17)14-16-21(22)27(24,25)18-11-7-4-8-12-18/h3-16,19-22H,1-2H3/b15-13+/t19?,20-,21+,22?/m1/s1 |
| InChIKey | OXTWASYATLUDPB-WZOKJVATSA-N |
| XLogP | 4.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|