C19H24O3S — CID 11450404
1-methyl-4-[(2R)-2-phenylmethoxypentyl]sulfonylbenzene (PubChem CID 11450404) has the molecular formula C19H24O3S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-methyl-4-[(2R)-2-phenylmethoxypentyl]sulfonylbenzene.
| Compound Name | 1-methyl-4-[(2R)-2-phenylmethoxypentyl]sulfonylbenzene |
|---|---|
| PubChem CID | 11450404 |
| Molecular Formula | C19H24O3S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-methyl-4-[(2R)-2-phenylmethoxypentyl]sulfonylbenzene |
| SMILES | CCC[C@H](CS(=O)(=O)c1ccc(C)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C19H24O3S/c1-3-7-18(22-14-17-8-5-4-6-9-17)15-23(20,21)19-12-10-16(2)11-13-19/h4-6,8-13,18H,3,7,14-15H2,1-2H3/t18-/m1/s1 |
| InChIKey | UHFCFTHVXKIRQK-GOSISDBHSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |