C26H26O5S2 — CID 102462467
[(R)-[(1S)-4,4-bis(benzenesulfonyl)-2-methylidenecyclopentyl]-methoxymethyl]benzene (PubChem CID 102462467) has the molecular formula C26H26O5S2 and a molecular weight of 482.62 g/mol. Its IUPAC name is [(R)-[(1S)-4,4-bis(benzenesulfonyl)-2-methylidenecyclopentyl]-methoxymethyl]benzene.
| Compound Name | [(R)-[(1S)-4,4-bis(benzenesulfonyl)-2-methylidenecyclopentyl]-methoxymethyl]benzene |
|---|---|
| PubChem CID | 102462467 |
| Molecular Formula | C26H26O5S2 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | [(R)-[(1S)-4,4-bis(benzenesulfonyl)-2-methylidenecyclopentyl]-methoxymethyl]benzene |
| SMILES | C=C1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C[C@@H]1[C@@H](OC)c1ccccc1 |
| InChI | InChI=1S/C26H26O5S2/c1-20-18-26(32(27,28)22-14-8-4-9-15-22,33(29,30)23-16-10-5-11-17-23)19-24(20)25(31-2)21-12-6-3-7-13-21/h3-17,24-25H,1,18-19H2,2H3/t24-,25-/m0/s1 |
| InChIKey | ZCCSFMUPWMZALC-DQEYMECFSA-N |
| XLogP | 4.98 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|