C24H24O4S2 — CID 15741680
8,11-bis(benzenesulfonyl)tricyclo[4.3.3.01,6]dodeca-7,11-diene (PubChem CID 15741680) has the molecular formula C24H24O4S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 8,11-bis(benzenesulfonyl)tricyclo[4.3.3.01,6]dodeca-7,11-diene.
| Compound Name | 8,11-bis(benzenesulfonyl)tricyclo[4.3.3.01,6]dodeca-7,11-diene |
|---|---|
| PubChem CID | 15741680 |
| Molecular Formula | C24H24O4S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 8,11-bis(benzenesulfonyl)tricyclo[4.3.3.01,6]dodeca-7,11-diene |
| SMILES | O=S(=O)(C1=CC23C=C(S(=O)(=O)c4ccccc4)CC2(CCCC3)C1)c1ccccc1 |
| InChI | InChI=1S/C24H24O4S2/c25-29(26,19-9-3-1-4-10-19)21-15-23-13-7-8-14-24(23,16-21)18-22(17-23)30(27,28)20-11-5-2-6-12-20/h1-6,9-12,15,17H,7-8,13-14,16,18H2 |
| InChIKey | MLFIIBMDGHKNPF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |