C27H26O6S3 — CID 15758915
(1E)-1,3,3-tris(benzenesulfonyl)-8-methylidenecyclooctene (PubChem CID 15758915) has the molecular formula C27H26O6S3 and a molecular weight of 542.70 g/mol. Its IUPAC name is (1E)-1,3,3-tris(benzenesulfonyl)-8-methylidenecyclooctene.
| Compound Name | (1E)-1,3,3-tris(benzenesulfonyl)-8-methylidenecyclooctene |
|---|---|
| PubChem CID | 15758915 |
| Molecular Formula | C27H26O6S3 |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | (1E)-1,3,3-tris(benzenesulfonyl)-8-methylidenecyclooctene |
| SMILES | C=C1CCCCC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)/C=C\1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H26O6S3/c1-22-13-11-12-20-27(35(30,31)24-16-7-3-8-17-24,36(32,33)25-18-9-4-10-19-25)21-26(22)34(28,29)23-14-5-2-6-15-23/h2-10,14-19,21H,1,11-13,20H2/b26-21+ |
| InChIKey | QTVZGQGYEUKXNR-YYADALCUSA-N |
| XLogP | 5.12 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |