C13H12O2S — CID 15499467
1-(benzenesulfonyl)cyclohepta-1,3,5-triene (PubChem CID 15499467) has the molecular formula C13H12O2S and a molecular weight of 232.30 g/mol. Its IUPAC name is 1-(benzenesulfonyl)cyclohepta-1,3,5-triene.
| Compound Name | 1-(benzenesulfonyl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 15499467 |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 1-(benzenesulfonyl)cyclohepta-1,3,5-triene |
| SMILES | O=S(=O)(C1=CC=CC=CC1)c1ccccc1 |
| InChI | InChI=1S/C13H12O2S/c14-16(15,13-10-6-3-7-11-13)12-8-4-1-2-5-9-12/h1-8,10-11H,9H2 |
| InChIKey | WMUVKQRPNXGPCW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |