C14H14O2S — CID 142168191
2-(benzenesulfonyl)-3-methylcyclohepta-1,3,5-triene (PubChem CID 142168191) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-methylcyclohepta-1,3,5-triene.
| Compound Name | 2-(benzenesulfonyl)-3-methylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142168191 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-(benzenesulfonyl)-3-methylcyclohepta-1,3,5-triene |
| SMILES | CC1=CC=CCC=C1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14O2S/c1-12-8-4-2-7-11-14(12)17(15,16)13-9-5-3-6-10-13/h2-6,8-11H,7H2,1H3 |
| InChIKey | RXYJXYCOCUZHLV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |