C12H14O2S — CID 15082335
(2,3,3-trimethylcyclopropen-1-yl)sulfonylbenzene (PubChem CID 15082335) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is (2,3,3-trimethylcyclopropen-1-yl)sulfonylbenzene.
| Compound Name | (2,3,3-trimethylcyclopropen-1-yl)sulfonylbenzene |
|---|---|
| PubChem CID | 15082335 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (2,3,3-trimethylcyclopropen-1-yl)sulfonylbenzene |
| SMILES | CC1=C(S(=O)(=O)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C12H14O2S/c1-9-11(12(9,2)3)15(13,14)10-7-5-4-6-8-10/h4-8H,1-3H3 |
| InChIKey | BHEHTORRNMUCJA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |