C13H14O4S — CID 12709521
3-(benzenesulfonyl)-4,5,5-trimethylfuran-2-one (PubChem CID 12709521) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4,5,5-trimethylfuran-2-one.
| Compound Name | 3-(benzenesulfonyl)-4,5,5-trimethylfuran-2-one |
|---|---|
| PubChem CID | 12709521 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 3-(benzenesulfonyl)-4,5,5-trimethylfuran-2-one |
| SMILES | CC1=C(S(=O)(=O)c2ccccc2)C(=O)OC1(C)C |
| InChI | InChI=1S/C13H14O4S/c1-9-11(12(14)17-13(9,2)3)18(15,16)10-7-5-4-6-8-10/h4-8H,1-3H3 |
| InChIKey | KSHJQGGOJOWXBZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |