About 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one
3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one (PubChem CID 555917) has the molecular formula C19H17NO5S2
and a molecular weight of 403.48 g/mol. Its IUPAC name is 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one |
| PubChem CID | 555917 |
| Molecular Formula | C19H17NO5S2 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one |
| SMILES | Cc1[nH]c(C)c(S(=O)(=O)c2ccccc2)c(=O)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17NO5S2/c1-13-18(26(22,23)15-9-5-3-6-10-15)17(21)19(14(2)20-13)27(24,25)16-11-7-4-8-12-16/h3-12H,1-2H3,(H,20,21) |
| InChIKey | ZFSSEBUJORGIJG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one?
The IUPAC name of 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one (CID 555917) is 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one.
What is the SMILES notation for 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one?
The canonical SMILES for 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one is Cc1[nH]c(C)c(S(=O)(=O)c2ccccc2)c(=O)c1S(=O)(=O)c1ccccc1.
What is the InChIKey of 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one?
The InChIKey is ZFSSEBUJORGIJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO5S2/c1-13-18(26(22,23)15-9-5-3-6-10-15)17(21)19(14(2)20-13)27(24,25)16-11-7-4-8-12-16/h3-12H,1-2H3,(H,20,21).
What are the key properties of 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one?
3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one has a molecular weight of 403.48 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(benzenesulfonyl)-2,6-dimethyl-1H-pyridin-4-one is sourced from PubChem (CID 555917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).