C13H11Cl2NO2S — CID 555200
4-(benzenesulfonyl)-3,5-dichloro-2,6-dimethylpyridine (PubChem CID 555200) has the molecular formula C13H11Cl2NO2S and a molecular weight of 316.21 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-3,5-dichloro-2,6-dimethylpyridine.
| Compound Name | 4-(benzenesulfonyl)-3,5-dichloro-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 555200 |
| Molecular Formula | C13H11Cl2NO2S |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 4-(benzenesulfonyl)-3,5-dichloro-2,6-dimethylpyridine |
| SMILES | Cc1nc(C)c(Cl)c(S(=O)(=O)c2ccccc2)c1Cl |
| InChI | InChI=1S/C13H11Cl2NO2S/c1-8-11(14)13(12(15)9(2)16-8)19(17,18)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | TVPAUTJCHZBQQI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |