C17H15NO4S — CID 142667582
5-(benzenesulfonyl)-2,4,6-trimethylisoindole-1,3-dione (PubChem CID 142667582) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-2,4,6-trimethylisoindole-1,3-dione.
| Compound Name | 5-(benzenesulfonyl)-2,4,6-trimethylisoindole-1,3-dione |
|---|---|
| PubChem CID | 142667582 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 5-(benzenesulfonyl)-2,4,6-trimethylisoindole-1,3-dione |
| SMILES | Cc1cc2c(c(C)c1S(=O)(=O)c1ccccc1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C17H15NO4S/c1-10-9-13-14(17(20)18(3)16(13)19)11(2)15(10)23(21,22)12-7-5-4-6-8-12/h4-9H,1-3H3 |
| InChIKey | JFMWKYMXHYPPJF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|