About 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene
2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene (PubChem CID 139788361) has the molecular formula C16H18O4S2
and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene |
| PubChem CID | 139788361 |
| Molecular Formula | C16H18O4S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(S(=O)(=O)CS(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C16H18O4S2/c1-12-9-13(2)16(14(3)10-12)22(19,20)11-21(17,18)15-7-5-4-6-8-15/h4-10H,11H2,1-3H3 |
| InChIKey | KVZIEBXCPBXPQS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene?
The IUPAC name of 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene (CID 139788361) is 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene?
The canonical SMILES for 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene is Cc1cc(C)c(S(=O)(=O)CS(=O)(=O)c2ccccc2)c(C)c1.
What is the InChIKey of 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene?
The InChIKey is KVZIEBXCPBXPQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O4S2/c1-12-9-13(2)16(14(3)10-12)22(19,20)11-21(17,18)15-7-5-4-6-8-15/h4-10H,11H2,1-3H3.
What are the key properties of 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene?
2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene has a molecular weight of 338.45 g/mol, XLogP of 2.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene is sourced from PubChem (CID 139788361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).