C16H18O4S2 — CID 139788361
2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene (PubChem CID 139788361) has the molecular formula C16H18O4S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene.
| Compound Name | 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 139788361 |
| Molecular Formula | C16H18O4S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-(benzenesulfonylmethylsulfonyl)-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(S(=O)(=O)CS(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C16H18O4S2/c1-12-9-13(2)16(14(3)10-12)22(19,20)11-21(17,18)15-7-5-4-6-8-15/h4-10H,11H2,1-3H3 |
| InChIKey | KVZIEBXCPBXPQS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |