C12H16O3S — CID 28753715
1-(2,4,6-trimethylphenyl)sulfonylpropan-2-one (PubChem CID 28753715) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)sulfonylpropan-2-one.
| Compound Name | 1-(2,4,6-trimethylphenyl)sulfonylpropan-2-one |
|---|---|
| PubChem CID | 28753715 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)sulfonylpropan-2-one |
| SMILES | CC(=O)CS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C12H16O3S/c1-8-5-9(2)12(10(3)6-8)16(14,15)7-11(4)13/h5-6H,7H2,1-4H3 |
| InChIKey | QIMXXDFNMZTXKC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |