C14H19NO5S — CID 174894280
[ethyl(2-oxopropanoyl)amino] 2,4,6-trimethylbenzenesulfonate (PubChem CID 174894280) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is [ethyl(2-oxopropanoyl)amino] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [ethyl(2-oxopropanoyl)amino] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 174894280 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | [ethyl(2-oxopropanoyl)amino] 2,4,6-trimethylbenzenesulfonate |
| SMILES | CCN(OS(=O)(=O)c1c(C)cc(C)cc1C)C(=O)C(C)=O |
| InChI | InChI=1S/C14H19NO5S/c1-6-15(14(17)12(5)16)20-21(18,19)13-10(3)7-9(2)8-11(13)4/h7-8H,6H2,1-5H3 |
| InChIKey | TXEJVTCLAZRBHP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|