C13H19NO4S — CID 6282444
ethyl (1E)-N-(2,4,6-trimethylphenyl)sulfonyloxyethanimidate (PubChem CID 6282444) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is ethyl (1E)-N-(2,4,6-trimethylphenyl)sulfonyloxyethanimidate.
| Compound Name | ethyl (1E)-N-(2,4,6-trimethylphenyl)sulfonyloxyethanimidate |
|---|---|
| PubChem CID | 6282444 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | ethyl (1E)-N-(2,4,6-trimethylphenyl)sulfonyloxyethanimidate |
| SMILES | CCO/C(C)=N/OS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C13H19NO4S/c1-6-17-12(5)14-18-19(15,16)13-10(3)7-9(2)8-11(13)4/h7-8H,6H2,1-5H3/b14-12+ |
| InChIKey | KQCBSWBQAXTILK-WYMLVPIESA-N |
| XLogP | 2.69 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|