C19H30O4S — CID 13003290
(2-oxo-3-propylheptyl) 2,4,6-trimethylbenzenesulfonate (PubChem CID 13003290) has the molecular formula C19H30O4S and a molecular weight of 354.51 g/mol. Its IUPAC name is (2-oxo-3-propylheptyl) 2,4,6-trimethylbenzenesulfonate.
| Compound Name | (2-oxo-3-propylheptyl) 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 13003290 |
| Molecular Formula | C19H30O4S |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (2-oxo-3-propylheptyl) 2,4,6-trimethylbenzenesulfonate |
| SMILES | CCCCC(CCC)C(=O)COS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C19H30O4S/c1-6-8-10-17(9-7-2)18(20)13-23-24(21,22)19-15(4)11-14(3)12-16(19)5/h11-12,17H,6-10,13H2,1-5H3 |
| InChIKey | RDJOCRJKXNKJDX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|