C16H22O5 — CID 129384345
(1S,4R,7S)-4-tert-butyl-1-phenyl-2,3,5,6,11-pentaoxabicyclo[5.3.1]undecane (PubChem CID 129384345) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (1S,4R,7S)-4-tert-butyl-1-phenyl-2,3,5,6,11-pentaoxabicyclo[5.3.1]undecane.
| Compound Name | (1S,4R,7S)-4-tert-butyl-1-phenyl-2,3,5,6,11-pentaoxabicyclo[5.3.1]undecane |
|---|---|
| PubChem CID | 129384345 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (1S,4R,7S)-4-tert-butyl-1-phenyl-2,3,5,6,11-pentaoxabicyclo[5.3.1]undecane |
| SMILES | CC(C)(C)[C@@H]1OO[C@H]2CCC[C@@](c3ccccc3)(OO1)O2 |
| InChI | InChI=1S/C16H22O5/c1-15(2,3)14-19-18-13-10-7-11-16(17-13,21-20-14)12-8-5-4-6-9-12/h4-6,8-9,13-14H,7,10-11H2,1-3H3/t13-,14+,16-/m0/s1 |
| InChIKey | ZTNIVRAIMLMSFO-LZWOXQAQSA-N |
| XLogP | 3.65 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|