C18H16ClNO2 — CID 102209411
(1R,4S,5S)-4-(4-chlorophenyl)-1,6-dimethyl-5-phenyl-3-oxa-6-azabicyclo[3.1.0]hexan-2-one (PubChem CID 102209411) has the molecular formula C18H16ClNO2 and a molecular weight of 313.78 g/mol. Its IUPAC name is (1R,4S,5S)-4-(4-chlorophenyl)-1,6-dimethyl-5-phenyl-3-oxa-6-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,4S,5S)-4-(4-chlorophenyl)-1,6-dimethyl-5-phenyl-3-oxa-6-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 102209411 |
| Molecular Formula | C18H16ClNO2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (1R,4S,5S)-4-(4-chlorophenyl)-1,6-dimethyl-5-phenyl-3-oxa-6-azabicyclo[3.1.0]hexan-2-one |
| SMILES | CN1[C@]2(c3ccccc3)[C@H](c3ccc(Cl)cc3)OC(=O)[C@]12C |
| InChI | InChI=1S/C18H16ClNO2/c1-17-16(21)22-15(12-8-10-14(19)11-9-12)18(17,20(17)2)13-6-4-3-5-7-13/h3-11,15H,1-2H3/t15-,17-,18+,20?/m0/s1 |
| InChIKey | QSJGWMKNARQSBS-NDGNNOQLSA-N |
| XLogP | 3.54 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|