C20H19ClO2 — CID 175846373
(4E)-4-benzylidene-6-(4-chlorophenyl)-5,5-dimethyloxan-2-one (PubChem CID 175846373) has the molecular formula C20H19ClO2 and a molecular weight of 326.82 g/mol. Its IUPAC name is (4E)-4-benzylidene-6-(4-chlorophenyl)-5,5-dimethyloxan-2-one.
| Compound Name | (4E)-4-benzylidene-6-(4-chlorophenyl)-5,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 175846373 |
| Molecular Formula | C20H19ClO2 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (4E)-4-benzylidene-6-(4-chlorophenyl)-5,5-dimethyloxan-2-one |
| SMILES | CC1(C)/C(=C/c2ccccc2)CC(=O)OC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClO2/c1-20(2)16(12-14-6-4-3-5-7-14)13-18(22)23-19(20)15-8-10-17(21)11-9-15/h3-12,19H,13H2,1-2H3/b16-12+ |
| InChIKey | BCPKWJYSMRGKGF-FOWTUZBSSA-N |
| XLogP | 5.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |