C24H22ClNO — CID 101258147
(3S,7aS)-3-(4-chlorophenyl)-1,1-diphenyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole (PubChem CID 101258147) has the molecular formula C24H22ClNO and a molecular weight of 375.90 g/mol. Its IUPAC name is (3S,7aS)-3-(4-chlorophenyl)-1,1-diphenyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (3S,7aS)-3-(4-chlorophenyl)-1,1-diphenyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 101258147 |
| Molecular Formula | C24H22ClNO |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (3S,7aS)-3-(4-chlorophenyl)-1,1-diphenyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole |
| SMILES | Clc1ccc([C@@H]2OC(c3ccccc3)(c3ccccc3)[C@@H]3CCCN32)cc1 |
| InChI | InChI=1S/C24H22ClNO/c25-21-15-13-18(14-16-21)23-26-17-7-12-22(26)24(27-23,19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-6,8-11,13-16,22-23H,7,12,17H2/t22-,23-/m0/s1 |
| InChIKey | QPBPNSRFGDDBCQ-GOTSBHOMSA-N |
| XLogP | 5.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |