C31H30ClNO — CID 139226581
(6'E)-6'-benzylidene-5-(4-chlorophenyl)-6-phenylspiro[1,2,3,5,6,8-hexahydropyrrolizine-7,2'-cyclohexane]-1'-one (PubChem CID 139226581) has the molecular formula C31H30ClNO and a molecular weight of 468.04 g/mol. Its IUPAC name is (6'E)-6'-benzylidene-5-(4-chlorophenyl)-6-phenylspiro[1,2,3,5,6,8-hexahydropyrrolizine-7,2'-cyclohexane]-1'-one.
| Compound Name | (6'E)-6'-benzylidene-5-(4-chlorophenyl)-6-phenylspiro[1,2,3,5,6,8-hexahydropyrrolizine-7,2'-cyclohexane]-1'-one |
|---|---|
| PubChem CID | 139226581 |
| Molecular Formula | C31H30ClNO |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | (6'E)-6'-benzylidene-5-(4-chlorophenyl)-6-phenylspiro[1,2,3,5,6,8-hexahydropyrrolizine-7,2'-cyclohexane]-1'-one |
| SMILES | O=C1/C(=C/c2ccccc2)CCCC12C(c1ccccc1)C(c1ccc(Cl)cc1)N1CCCC12 |
| InChI | InChI=1S/C31H30ClNO/c32-26-17-15-24(16-18-26)29-28(23-11-5-2-6-12-23)31(27-14-8-20-33(27)29)19-7-13-25(30(31)34)21-22-9-3-1-4-10-22/h1-6,9-12,15-18,21,27-29H,7-8,13-14,19-20H2/b25-21+ |
| InChIKey | SNUARKOVELSZKZ-NJNXFGOHSA-N |
| XLogP | 7.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|