C33H35NO3 — CID 139226582
(6'E)-6'-benzylidene-5-(3,4-dimethoxyphenyl)-6-phenylspiro[1,2,3,5,6,8-hexahydropyrrolizine-7,2'-cyclohexane]-1'-one (PubChem CID 139226582) has the molecular formula C33H35NO3 and a molecular weight of 493.65 g/mol. Its IUPAC name is (6'E)-6'-benzylidene-5-(3,4-dimethoxyphenyl)-6-phenylspiro[1,2,3,5,6,8-hexahydropyrrolizine-7,2'-cyclohexane]-1'-one.
| Compound Name | (6'E)-6'-benzylidene-5-(3,4-dimethoxyphenyl)-6-phenylspiro[1,2,3,5,6,8-hexahydropyrrolizine-7,2'-cyclohexane]-1'-one |
|---|---|
| PubChem CID | 139226582 |
| Molecular Formula | C33H35NO3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (6'E)-6'-benzylidene-5-(3,4-dimethoxyphenyl)-6-phenylspiro[1,2,3,5,6,8-hexahydropyrrolizine-7,2'-cyclohexane]-1'-one |
| SMILES | COc1ccc(C2C(c3ccccc3)C3(CCC/C(=C\c4ccccc4)C3=O)C3CCCN23)cc1OC |
| InChI | InChI=1S/C33H35NO3/c1-36-27-18-17-25(22-28(27)37-2)31-30(24-13-7-4-8-14-24)33(29-16-10-20-34(29)31)19-9-15-26(32(33)35)21-23-11-5-3-6-12-23/h3-8,11-14,17-18,21-22,29-31H,9-10,15-16,19-20H2,1-2H3/b26-21+ |
| InChIKey | YRFRYWVOPIJHNS-YYADALCUSA-N |
| XLogP | 6.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|