C25H25NO3 — CID 42936298
[2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-(4-phenylphenyl)methanone (PubChem CID 42936298) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-(4-phenylphenyl)methanone.
| Compound Name | [2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 42936298 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-(4-phenylphenyl)methanone |
| SMILES | COc1ccc(C2CCCN2C(=O)c2ccc(-c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C25H25NO3/c1-28-23-15-14-21(17-24(23)29-2)22-9-6-16-26(22)25(27)20-12-10-19(11-13-20)18-7-4-3-5-8-18/h3-5,7-8,10-15,17,22H,6,9,16H2,1-2H3 |
| InChIKey | BPSUBGCGMRTWHT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |