C21H25N3O4 — CID 42938821
[4-[2-(3,4-dimethoxyphenyl)pyrrolidine-1-carbonyl]phenyl]methylurea (PubChem CID 42938821) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is [4-[2-(3,4-dimethoxyphenyl)pyrrolidine-1-carbonyl]phenyl]methylurea.
| Compound Name | [4-[2-(3,4-dimethoxyphenyl)pyrrolidine-1-carbonyl]phenyl]methylurea |
|---|---|
| PubChem CID | 42938821 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [4-[2-(3,4-dimethoxyphenyl)pyrrolidine-1-carbonyl]phenyl]methylurea |
| SMILES | COc1ccc(C2CCCN2C(=O)c2ccc(CNC(N)=O)cc2)cc1OC |
| InChI | InChI=1S/C21H25N3O4/c1-27-18-10-9-16(12-19(18)28-2)17-4-3-11-24(17)20(25)15-7-5-14(6-8-15)13-23-21(22)26/h5-10,12,17H,3-4,11,13H2,1-2H3,(H3,22,23,26) |
| InChIKey | JNELNDSYCUJLFZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |