C25H28N4O5 — CID 46511007
[2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]methanone (PubChem CID 46511007) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]methanone.
| Compound Name | [2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 46511007 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]methanone |
| SMILES | COc1ccc(C2CCCN2C(=O)c2ccc(Cn3nc(C)c([N+](=O)[O-])c3C)cc2)cc1OC |
| InChI | InChI=1S/C25H28N4O5/c1-16-24(29(31)32)17(2)28(26-16)15-18-7-9-19(10-8-18)25(30)27-13-5-6-21(27)20-11-12-22(33-3)23(14-20)34-4/h7-12,14,21H,5-6,13,15H2,1-4H3 |
| InChIKey | FGTYPNJMSLIOCJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|