C39H29F2NO2 — CID 44583310
CID 44583310 (PubChem CID 44583310) has the molecular formula C39H29F2NO2 and a molecular weight of 581.66 g/mol.
| Compound Name | CID 44583310 |
|---|---|
| PubChem CID | 44583310 |
| Molecular Formula | C39H29F2NO2 |
| Molecular Weight | 581.66 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | — |
| SMILES | O=C1c2cccc3cccc(c23)[C@]12N[C@@H](c1ccccc1)[C@H](c1ccc(F)cc1)[C@]21CCC/C(=C\c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C39H29F2NO2/c40-29-18-14-24(15-19-29)23-28-11-6-22-38(36(28)43)34(26-16-20-30(41)21-17-26)35(27-7-2-1-3-8-27)42-39(38)32-13-5-10-25-9-4-12-31(33(25)32)37(39)44/h1-5,7-10,12-21,23,34-35,42H,6,11,22H2/b28-23+/t34-,35-,38-,39-/m0/s1 |
| InChIKey | SRLAZVAJADSVCJ-SAOSFIDQSA-N |
| XLogP | 8.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.66 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|