C21H20F2O3 — CID 9042227
(2E,6R)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-6-phenylcyclohexan-1-one (PubChem CID 9042227) has the molecular formula C21H20F2O3 and a molecular weight of 358.38 g/mol. Its IUPAC name is (2E,6R)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-6-phenylcyclohexan-1-one.
| Compound Name | (2E,6R)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-6-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 9042227 |
| Molecular Formula | C21H20F2O3 |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (2E,6R)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-6-phenylcyclohexan-1-one |
| SMILES | COc1cc(/C=C2\CCC[C@H](c3ccccc3)C2=O)ccc1OC(F)F |
| InChI | InChI=1S/C21H20F2O3/c1-25-19-13-14(10-11-18(19)26-21(22)23)12-16-8-5-9-17(20(16)24)15-6-3-2-4-7-15/h2-4,6-7,10-13,17,21H,5,8-9H2,1H3/b16-12+/t17-/m1/s1 |
| InChIKey | YWOBHSNEMWZUCS-NWNNTGRJSA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|