C20H18F2O4 — CID 60583292
(3E)-3-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-5,7-dimethylchromen-4-one (PubChem CID 60583292) has the molecular formula C20H18F2O4 and a molecular weight of 360.36 g/mol. Its IUPAC name is (3E)-3-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-5,7-dimethylchromen-4-one.
| Compound Name | (3E)-3-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-5,7-dimethylchromen-4-one |
|---|---|
| PubChem CID | 60583292 |
| Molecular Formula | C20H18F2O4 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (3E)-3-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-5,7-dimethylchromen-4-one |
| SMILES | COc1cc(/C=C2\COc3cc(C)cc(C)c3C2=O)ccc1OC(F)F |
| InChI | InChI=1S/C20H18F2O4/c1-11-6-12(2)18-17(7-11)25-10-14(19(18)23)8-13-4-5-15(26-20(21)22)16(9-13)24-3/h4-9,20H,10H2,1-3H3/b14-8+ |
| InChIKey | FSLNEYFUOPVGEP-RIYZIHGNSA-N |
| XLogP | 4.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|