C19H17FO6 — CID 118908232
(3E)-3-[(3-fluoro-4-hydroxyphenyl)methylidene]-5,6,7-trimethoxychromen-4-one (PubChem CID 118908232) has the molecular formula C19H17FO6 and a molecular weight of 360.34 g/mol. Its IUPAC name is (3E)-3-[(3-fluoro-4-hydroxyphenyl)methylidene]-5,6,7-trimethoxychromen-4-one.
| Compound Name | (3E)-3-[(3-fluoro-4-hydroxyphenyl)methylidene]-5,6,7-trimethoxychromen-4-one |
|---|---|
| PubChem CID | 118908232 |
| Molecular Formula | C19H17FO6 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (3E)-3-[(3-fluoro-4-hydroxyphenyl)methylidene]-5,6,7-trimethoxychromen-4-one |
| SMILES | COc1cc2c(c(OC)c1OC)C(=O)/C(=C/c1ccc(O)c(F)c1)CO2 |
| InChI | InChI=1S/C19H17FO6/c1-23-15-8-14-16(19(25-3)18(15)24-2)17(22)11(9-26-14)6-10-4-5-13(21)12(20)7-10/h4-8,21H,9H2,1-3H3/b11-6+ |
| InChIKey | VDRQRNJTYRZCBB-IZZDOVSWSA-N |
| XLogP | 3.22 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|