C18H14F2O2 — CID 60583274
(3E)-3-[(3,4-difluorophenyl)methylidene]-5,7-dimethylchromen-4-one (PubChem CID 60583274) has the molecular formula C18H14F2O2 and a molecular weight of 300.30 g/mol. Its IUPAC name is (3E)-3-[(3,4-difluorophenyl)methylidene]-5,7-dimethylchromen-4-one.
| Compound Name | (3E)-3-[(3,4-difluorophenyl)methylidene]-5,7-dimethylchromen-4-one |
|---|---|
| PubChem CID | 60583274 |
| Molecular Formula | C18H14F2O2 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (3E)-3-[(3,4-difluorophenyl)methylidene]-5,7-dimethylchromen-4-one |
| SMILES | Cc1cc(C)c2c(c1)OC/C(=C\c1ccc(F)c(F)c1)C2=O |
| InChI | InChI=1S/C18H14F2O2/c1-10-5-11(2)17-16(6-10)22-9-13(18(17)21)7-12-3-4-14(19)15(20)8-12/h3-8H,9H2,1-2H3/b13-7+ |
| InChIKey | YRAIOYLHWAKJRP-NTUHNPAUSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|