C19H19NO4 — CID 25242106
(3E)-3-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-5H-1,5-benzoxazepin-4-one (PubChem CID 25242106) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is (3E)-3-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-5H-1,5-benzoxazepin-4-one.
| Compound Name | (3E)-3-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-5H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 25242106 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (3E)-3-[(3,4-dimethoxyphenyl)methylidene]-7-methyl-5H-1,5-benzoxazepin-4-one |
| SMILES | COc1ccc(/C=C2\COc3ccc(C)cc3NC2=O)cc1OC |
| InChI | InChI=1S/C19H19NO4/c1-12-4-6-16-15(8-12)20-19(21)14(11-24-16)9-13-5-7-17(22-2)18(10-13)23-3/h4-10H,11H2,1-3H3,(H,20,21)/b14-9+ |
| InChIKey | JNEQTUZTONTWBE-NTEUORMPSA-N |
| XLogP | 3.43 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|