C22H23NO5 — CID 95041743
2-[4-[(Z)-(6,8-dimethyl-4-oxochromen-3-ylidene)methyl]-2-methoxyphenoxy]-N-methylacetamide (PubChem CID 95041743) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[4-[(Z)-(6,8-dimethyl-4-oxochromen-3-ylidene)methyl]-2-methoxyphenoxy]-N-methylacetamide.
| Compound Name | 2-[4-[(Z)-(6,8-dimethyl-4-oxochromen-3-ylidene)methyl]-2-methoxyphenoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 95041743 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[4-[(Z)-(6,8-dimethyl-4-oxochromen-3-ylidene)methyl]-2-methoxyphenoxy]-N-methylacetamide |
| SMILES | CNC(=O)COc1ccc(/C=C2/COc3c(C)cc(C)cc3C2=O)cc1OC |
| InChI | InChI=1S/C22H23NO5/c1-13-7-14(2)22-17(8-13)21(25)16(11-28-22)9-15-5-6-18(19(10-15)26-4)27-12-20(24)23-3/h5-10H,11-12H2,1-4H3,(H,23,24)/b16-9- |
| InChIKey | FAVNIGVBHGHXIJ-SXGWCWSVSA-N |
| XLogP | 3.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|