C24H28O2 — CID 163302819
(6E)-2-[(3,4-dimethylphenyl)methyl]-6-[(3-methoxy-4-methylphenyl)methylidene]cyclohexan-1-one (PubChem CID 163302819) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (6E)-2-[(3,4-dimethylphenyl)methyl]-6-[(3-methoxy-4-methylphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (6E)-2-[(3,4-dimethylphenyl)methyl]-6-[(3-methoxy-4-methylphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 163302819 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (6E)-2-[(3,4-dimethylphenyl)methyl]-6-[(3-methoxy-4-methylphenyl)methylidene]cyclohexan-1-one |
| SMILES | COc1cc(/C=C2\CCCC(Cc3ccc(C)c(C)c3)C2=O)ccc1C |
| InChI | InChI=1S/C24H28O2/c1-16-8-10-19(12-18(16)3)13-21-6-5-7-22(24(21)25)14-20-11-9-17(2)23(15-20)26-4/h8-12,14-15,21H,5-7,13H2,1-4H3/b22-14+ |
| InChIKey | FJYFJSASGJGZDQ-HYARGMPZSA-N |
| XLogP | 5.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|