C20H19NO5 — CID 9042236
(2E,6S)-2-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-6-phenylcyclohexan-1-one (PubChem CID 9042236) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is (2E,6S)-2-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-6-phenylcyclohexan-1-one.
| Compound Name | (2E,6S)-2-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-6-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 9042236 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (2E,6S)-2-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-6-phenylcyclohexan-1-one |
| SMILES | COc1cc(/C=C2\CCC[C@@H](c3ccccc3)C2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C20H19NO5/c1-26-18-12-13(11-17(20(18)23)21(24)25)10-15-8-5-9-16(19(15)22)14-6-3-2-4-7-14/h2-4,6-7,10-12,16,23H,5,8-9H2,1H3/b15-10+/t16-/m0/s1 |
| InChIKey | GBRWFCLEIFBYAN-KMPOOHAWSA-N |
| XLogP | 4.23 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|