C27H23Cl2N3S — CID 25333808
(3S,3aS,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-N-phenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide (PubChem CID 25333808) has the molecular formula C27H23Cl2N3S and a molecular weight of 492.48 g/mol. Its IUPAC name is (3S,3aS,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-N-phenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide.
| Compound Name | (3S,3aS,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-N-phenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide |
|---|---|
| PubChem CID | 25333808 |
| Molecular Formula | C27H23Cl2N3S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | (3S,3aS,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-N-phenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide |
| SMILES | S=C(Nc1ccccc1)N1N=C2/C(=C/c3ccc(Cl)cc3)CCC[C@H]2[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H23Cl2N3S/c28-21-13-9-18(10-14-21)17-20-5-4-8-24-25(20)31-32(26(24)19-11-15-22(29)16-12-19)27(33)30-23-6-2-1-3-7-23/h1-3,6-7,9-17,24,26H,4-5,8H2,(H,30,33)/b20-17+/t24-,26-/m1/s1 |
| InChIKey | SYYDJKMBCPYRHT-INYGDSQJSA-N |
| XLogP | 7.99 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|