C27H22Cl2N2OS — CID 26857296
(E)-1-[(3R,3aS,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 26857296) has the molecular formula C27H22Cl2N2OS and a molecular weight of 493.46 g/mol. Its IUPAC name is (E)-1-[(3R,3aS,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[(3R,3aS,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 26857296 |
| Molecular Formula | C27H22Cl2N2OS |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | (E)-1-[(3R,3aS,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccs1)N1N=C2/C(=C/c3ccc(Cl)cc3)CCC[C@H]2[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22Cl2N2OS/c28-21-10-6-18(7-11-21)17-20-3-1-5-24-26(20)30-31(25(32)15-14-23-4-2-16-33-23)27(24)19-8-12-22(29)13-9-19/h2,4,6-17,24,27H,1,3,5H2/b15-14+,20-17+/t24-,27+/m1/s1 |
| InChIKey | YIBDAZBLSVXIOG-FVALRFBTSA-N |
| XLogP | 7.89 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|