C32H35ClN4OS — CID 129449602
1-[(3R,3aS,7Z)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(4-chlorophenyl)sulfanylethanone (PubChem CID 129449602) has the molecular formula C32H35ClN4OS and a molecular weight of 559.18 g/mol. Its IUPAC name is 1-[(3R,3aS,7Z)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(4-chlorophenyl)sulfanylethanone.
| Compound Name | 1-[(3R,3aS,7Z)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(4-chlorophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 129449602 |
| Molecular Formula | C32H35ClN4OS |
| Molecular Weight | 559.18 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 1-[(3R,3aS,7Z)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(4-chlorophenyl)sulfanylethanone |
| SMILES | CN(C)c1ccc(/C=C2/CCC[C@@H]3C2=NN(C(=O)CSc2ccc(Cl)cc2)[C@H]3c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H35ClN4OS/c1-35(2)26-14-8-22(9-15-26)20-24-6-5-7-29-31(24)34-37(30(38)21-39-28-18-12-25(33)13-19-28)32(29)23-10-16-27(17-11-23)36(3)4/h8-20,29,32H,5-7,21H2,1-4H3/b24-20-/t29-,32+/m1/s1 |
| InChIKey | XJVWZSUDCMTEDP-WGRSGYLCSA-N |
| XLogP | 7.39 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.18 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|