C32H34N4O3 — CID 3497527
2-[3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]benzoic acid (PubChem CID 3497527) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is 2-[3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]benzoic acid.
| Compound Name | 2-[3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 3497527 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 2-[3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]benzoic acid |
| SMILES | CN(C)c1ccc(C=C2CCCC3C2=NN(C(=O)c2ccccc2C(=O)O)C3c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H34N4O3/c1-34(2)24-16-12-21(13-17-24)20-23-8-7-11-28-29(23)33-36(30(28)22-14-18-25(19-15-22)35(3)4)31(37)26-9-5-6-10-27(26)32(38)39/h5-6,9-10,12-20,28,30H,7-8,11H2,1-4H3,(H,38,39) |
| InChIKey | DMCYFBIKHAAKSS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|